CAS 55687-05-3 appears in our catalog under these names: 2,5–Dichloroquinoxaline, 2,5-Dichloroquinoxaline 97%, 2,5-Dichloroquinoxaline, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
2,5-dichloroquinoxaline (CAS 55687-05-3) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,5-dichloroquinoxaline. InChIKey: UMVYPMIZWHTLFF-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,5-dichloroquinoxaline |
| InChIKey | UMVYPMIZWHTLFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)