CAS 5576-98-7 is the registry number for 1-Nitro-4-(2-nitroethenyl)benzene. Offered by: Biosynth. Available pack sizes: 2,5g.
1-nitro-4-[(E)-2-nitroethenyl]benzene (CAS 5576-98-7) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 1-nitro-4-[(E)-2-nitroethenyl]benzene. InChIKey: HABXLWPUIWFTNM-AATRIKPKSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 1-nitro-4-[(E)-2-nitroethenyl]benzene |
| InChIKey | HABXLWPUIWFTNM-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)