CAS 5627-73-6 is the registry number for 5–Chloro–2–methyl–4H–benzo(d)(1,3)oxazin–4–one. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
5-chloro-2-methyl-3,1-benzoxazin-4-one (CAS 5627-73-6) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 5-chloro-2-methyl-3,1-benzoxazin-4-one. InChIKey: HONXTRAMSCAREG-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-chloro-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | HONXTRAMSCAREG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CC=C2)Cl)C(=O)O1 |
Computed by PubChem (NCBI)