Products 56355-70-5
CAS 56355-70-5 appears in our catalog under these names: 2-Phenoxythiazole-5-carboxylic acid, 95%, 2-Phenoxythiazole-5-carboxylic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-phenoxy-1,3-thiazole-5-carboxylic acid (CAS 56355-70-5) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: 2-phenoxy-1,3-thiazole-5-carboxylic acid. InChIKey: BEVWBOAOASNRLZ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 2-phenoxy-1,3-thiazole-5-carboxylic acid |
| InChIKey | BEVWBOAOASNRLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)