Products 564443-30-7
CAS 564443-30-7 is the registry number for 6-Cyclopropylimidazo(2,1-b)(1,3)thiazole-5-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-cyclopropylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (CAS 564443-30-7) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 6-cyclopropylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde. InChIKey: DLXDDZCOOXLWAD-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 6-cyclopropylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| InChIKey | DLXDDZCOOXLWAD-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(N3C=CSC3=N2)C=O |
Computed by PubChem (NCBI)