CAS 56657-76-2 appears in our catalog under these names: 2,5-Dioxopyrrolidin-1-yl 2-cyanoacetate, 99.99%, 2,5-Dioxopyrrolidin-1-yl 2-cyanoacetate, 98%, Cyanoacetic Acid N-Hydroxysuccinimide Ester, Cyanoacetic acid–osu, Cyanoacetic acid-OSu 97%. Offered by: MedChemExpress, Fluorochem, TRC, GLPBio, Ambeed. Available pack sizes: 5 g, 25 g, 10 g, 1 g, 100 g, 50 g, 1g, 5g.
(2,5-dioxopyrrolidin-1-yl) 2-cyanoacetate (CAS 56657-76-2) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-cyanoacetate. InChIKey: OZLIBRFWDOSHRS-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-cyanoacetate |
| InChIKey | OZLIBRFWDOSHRS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CC#N |
Computed by PubChem (NCBI)