Products 5832-43-9
CAS 5832-43-9 appears in our catalog under these names: 4–Methyl–5–nitropicolinic acid, 4-Methyl-5-nitropicolinic acid 95%, 2-Pyridinecarboxylic acid, 4-methyl-5-nitro-, 95%, 95%, 4-Methyl-5-nitropicolinic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-methyl-5-nitropyridine-2-carboxylic acid (CAS 5832-43-9) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-methyl-5-nitropyridine-2-carboxylic acid. InChIKey: WRCSKWMCSRGUTG-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-methyl-5-nitropyridine-2-carboxylic acid |
| InChIKey | WRCSKWMCSRGUTG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)