CAS 58331-97-8 appears in our catalog under these names: Methyl 4-chloro-2-cyanobenzoate, 95%, 95%, Methyl 4-chloro-2-cyanobenzoate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Methyl 4-chloro-2-cyanobenzoate (CAS 58331-97-8) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: methyl 4-chloro-2-cyanobenzoate. InChIKey: JKAWTBOCEPQPBQ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | methyl 4-chloro-2-cyanobenzoate |
| InChIKey | JKAWTBOCEPQPBQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)C#N |
Computed by PubChem (NCBI)