CAS 58755-00-3 appears in our catalog under these names: 5-(2-Chlorophenyl)-4h-1,2,4-triazole-3-thiol, 95%, 5-(2-Chlorophenyl)-4H-1,2,4-triazole-3-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-(2-chlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 58755-00-3) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 5-(2-chlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: QYWRKNBGNJZYLS-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | QYWRKNBGNJZYLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=S)NN2)Cl |
Computed by PubChem (NCBI)