Products 59777-77-4
CAS 59777-77-4 is the registry number for Ethyl 5-(aminosulfonyl)-2-thiophenecarboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 5-sulfamoylthiophene-2-carboxylate (CAS 59777-77-4) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: ethyl 5-sulfamoylthiophene-2-carboxylate. InChIKey: RQSGIYNOGDUMIK-UHFFFAOYSA-N.
| Molecular formula | C7H9NO4S2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | ethyl 5-sulfamoylthiophene-2-carboxylate |
| InChIKey | RQSGIYNOGDUMIK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(S1)S(=O)(=O)N |
Computed by PubChem (NCBI)