CAS 59814-34-5 appears in our catalog under these names: 2-Chloro-5-propanoylbenzene-1-sulfonamide, 2-Chloro-5-propanoylbenzene-1-sulfonamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
2-chloro-5-propanoylbenzenesulfonamide (CAS 59814-34-5) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 2-chloro-5-propanoylbenzenesulfonamide. InChIKey: HNQOOWCYCALODH-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 2-chloro-5-propanoylbenzenesulfonamide |
| InChIKey | HNQOOWCYCALODH-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=C(C=C1)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)