CAS 60434-13-1 appears in our catalog under these names: 5–Chloro–1–methylisatin, 5-Chloro-1-methylisatin, >98.0%(GC), 5-Chloro-1-methylindoline-2,3-dione 98%, 5-Chloro-1-methylindoline-2,3-dione, 97%, 97%, 5-chloro-1-methyl-1H-indole-2,3-dione, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 200mg, 100mg, 10g.
5-chloro-1-methylindole-2,3-dione (CAS 60434-13-1) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 5-chloro-1-methylindole-2,3-dione. InChIKey: NJOPQQPDPYWFFA-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-chloro-1-methylindole-2,3-dione |
| InChIKey | NJOPQQPDPYWFFA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)C(=O)C1=O |
Computed by PubChem (NCBI)