CAS 610-36-6 appears in our catalog under these names: 4–Amino–2–nitrobenzoic Acid, 4-Amino-2-nitrobenzoic acid, 4-Amino-2-nitrobenzoic Acid, >98.0%(HPLC)(T), 4-Amino-2-nitro-benzoic acid 98%, 4-Amino-2-nitrobenzoic Acid, 97%, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 50g, 100g, 250g, 25g, 500g.
4-amino-2-nitrobenzoic acid (CAS 610-36-6) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-amino-2-nitrobenzoic acid. InChIKey: SAJYSJVBNGUWJK-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-amino-2-nitrobenzoic acid |
| InChIKey | SAJYSJVBNGUWJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)