CAS 610791-40-7 is the registry number for 1-(3-Chlorophenyl)cyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(3-chlorophenyl)cyclohexane-1-carboxylic acid (CAS 610791-40-7) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 1-(3-chlorophenyl)cyclohexane-1-carboxylic acid. InChIKey: IKAIZSGHPLHGLX-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 1-(3-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | IKAIZSGHPLHGLX-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)