Products 61258-72-8
CAS 61258-72-8 appears in our catalog under these names: 4-Chloro-7-methyl-1h-indole-2,3-dione, 95%, 4-Chloro-7-methylIsatin, 98%, 98%, 4-Chloro-7-methyl isatin, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
4-chloro-7-methyl-1H-indole-2,3-dione (CAS 61258-72-8) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 4-chloro-7-methyl-1H-indole-2,3-dione. InChIKey: MWCJCUFHPFXQLS-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 4-chloro-7-methyl-1H-indole-2,3-dione |
| InChIKey | MWCJCUFHPFXQLS-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
4-Chloro-7-methyl-1H-indole-2,3-dione, 4-chloro-7-methylisatin, 4-Chloro-7-methyl isatin, 1H-Indole-2,3-dione, 4-chloro-7-methyl-, 4-chloranyl-7-methyl-1H-indole-2,3-dione, 4-chloro-7-methylindoline-2,3-dione, 4-chloro-7-methyl-2,3-dihydro-1H-indole-2,3-dione, 1H-Indole-2,3-dione,4-chloro-7-methyl-, Cambridge id 5226020, Isatin-based compound, 55