CAS 61658-91-1 is the registry number for 2-(3-Oxoisobenzofuran-1(3H)-ylidene)-2-phenyl-acetic Acid (E/Z Mixture). Offered by: TRC. Available pack sizes: 1g.
2-(3-oxo-2-benzofuran-1-ylidene)-2-phenylacetic acid (CAS 61658-91-1) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: 2-(3-oxo-2-benzofuran-1-ylidene)-2-phenylacetic acid. InChIKey: FYVAVBJZCHTYMI-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 2-(3-oxo-2-benzofuran-1-ylidene)-2-phenylacetic acid |
| InChIKey | FYVAVBJZCHTYMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C2C3=CC=CC=C3C(=O)O2)C(=O)O |
Computed by PubChem (NCBI)