CAS 619-15-8 appears in our catalog under these names: 2,5-Dinitrotoluene, 95%, 2,5-Dinitrotoluene, >95% (HPLC), 2,5-Dinitrotoluene, Concentration: 100 µg/ml Solvent: Methanol, 2-Methyl-1,4-dinitrobenzene, 98%. Offered by: Combi-blocks, TRC, HPC Standards, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 1x5ml.
2-methyl-1,4-dinitrobenzene (CAS 619-15-8) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 2-methyl-1,4-dinitrobenzene. InChIKey: KZBOXYKTSUUBTO-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-methyl-1,4-dinitrobenzene |
| InChIKey | KZBOXYKTSUUBTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)