CAS 62484-29-1 appears in our catalog under these names: 2,4,8-Trichloroquinazoline 95%, 2,4,8-Trichloroquinazoline, 95%, 95%, 2,4,8-Trichloroquinazoline, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 2.5g, 10g.
2,4,8-trichloroquinazoline (CAS 62484-29-1) is a chemical compound with the molecular formula C8H3Cl3N2 and a molecular weight of 233.5 g/mol. IUPAC name: 2,4,8-trichloroquinazoline. InChIKey: XSZZHOALJUVOIG-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2 |
|---|---|
| Molecular weight | 233.5 g/mol |
| IUPAC name | 2,4,8-trichloroquinazoline |
| InChIKey | XSZZHOALJUVOIG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)