CAS 63197-17-1 is the registry number for 5-Chloro-2-methylisoindoline-1,3-dione, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloro-2-methylisoindole-1,3-dione (CAS 63197-17-1) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 5-chloro-2-methylisoindole-1,3-dione. InChIKey: DCFSQEWFDPNDPQ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-chloro-2-methylisoindole-1,3-dione |
| InChIKey | DCFSQEWFDPNDPQ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C1=O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)