CAS 63220-48-4 appears in our catalog under these names: 7-Chloro-1-methyl-1h-indole-2,3-dione, 95%, 7-Chloro-1-methyl-1H-indole-2,3-dione. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 0,5g, 50mg, 500mg.
7-chloro-1-methylindole-2,3-dione (CAS 63220-48-4) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 7-chloro-1-methylindole-2,3-dione. InChIKey: JRICJMZRQHSQKB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 7-chloro-1-methylindole-2,3-dione |
| InChIKey | JRICJMZRQHSQKB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2Cl)C(=O)C1=O |
Computed by PubChem (NCBI)