Products 63972-38-3
CAS 63972-38-3 is the registry number for LLL3, 97.20%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 10mM/1mL, 10 mg, 5 mg.
1-acetyl-5-hydroxyanthracene-9,10-dione (CAS 63972-38-3) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: 1-acetyl-5-hydroxyanthracene-9,10-dione. InChIKey: RROLKYCVTJGMND-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 1-acetyl-5-hydroxyanthracene-9,10-dione |
| InChIKey | RROLKYCVTJGMND-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC2=C1C(=O)C3=C(C2=O)C(=CC=C3)O |
Computed by PubChem (NCBI)