Products 64640-15-9
CAS 64640-15-9 appears in our catalog under these names: 2-(Chloromethyl)-5-(3-chlorophenyl)-1,3-oxazole, 95%, 2-(Chloromethyl)-5-(3-chlorophenyl)-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(chloromethyl)-5-(3-chlorophenyl)-1,3-oxazole (CAS 64640-15-9) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 2-(chloromethyl)-5-(3-chlorophenyl)-1,3-oxazole. InChIKey: XREYQNDZYBPWOE-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(3-chlorophenyl)-1,3-oxazole |
| InChIKey | XREYQNDZYBPWOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CN=C(O2)CCl |
Computed by PubChem (NCBI)