Products 650583-75-8

CAS 650583-75-8 is the registry number for 6,8-Dibromoquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

6,8-dibromoquinoline (CAS 650583-75-8) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 6,8-dibromoquinoline. InChIKey: ZOGJTWOWOXFJRU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5Br2N
Molecular weight286.95 g/mol
IUPAC name6,8-dibromoquinoline
InChIKeyZOGJTWOWOXFJRU-UHFFFAOYSA-N
SMILESC1=CC2=CC(=CC(=C2N=C1)Br)Br

Computed by PubChem (NCBI)