CAS 650583-75-8 is the registry number for 6,8-Dibromoquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
6,8-dibromoquinoline (CAS 650583-75-8) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 6,8-dibromoquinoline. InChIKey: ZOGJTWOWOXFJRU-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 6,8-dibromoquinoline |
| InChIKey | ZOGJTWOWOXFJRU-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)Br)Br |
Computed by PubChem (NCBI)