CAS 67643-31-6 appears in our catalog under these names: Ethyl 6–bromo–4–hydroxy–8–methylquinoline–3–carboxylate, Ethyl 6-bromo-4-hydroxy-8-methylquinoline-3-carboxylate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
Ethyl 6-bromo-8-methyl-4-oxo-1H-quinoline-3-carboxylate (CAS 67643-31-6) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: ethyl 6-bromo-8-methyl-4-oxo-1H-quinoline-3-carboxylate. InChIKey: UZXMPANUBSTXKN-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | ethyl 6-bromo-8-methyl-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | UZXMPANUBSTXKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2C)Br |
Computed by PubChem (NCBI)