CAS 677777-45-6 appears in our catalog under these names: 4-Cyano-3-methoxyphenylboronic acid, 95-<97%, 4-Cyano-3-methoxyphenylboronic acid, ≥97-<99%, (4–Cyano–3–methoxyphenyl)boronic acid (contains varying amounts of Anhydride), (4-Cyano-3-methoxyphenyl)boronic acid, 95%, (4-Cyano-3-methoxyphenyl)boronic acid, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Fluorochem, Ambeed. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 100mg, 1g.
(4-cyano-3-methoxyphenyl)boronic acid (CAS 677777-45-6) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (4-cyano-3-methoxyphenyl)boronic acid. InChIKey: YWZHJSBHFAFASK-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (4-cyano-3-methoxyphenyl)boronic acid |
| InChIKey | YWZHJSBHFAFASK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C#N)OC)(O)O |
Computed by PubChem (NCBI)