CAS 678165-08-7 appears in our catalog under these names: 4-(Chloromethyl)-2-(2-chlorophenyl)-1,3-oxazole, 95%, 4-(Chloromethyl)-2-(2-chlorophenyl)-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-(chloromethyl)-2-(2-chlorophenyl)-1,3-oxazole (CAS 678165-08-7) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 4-(chloromethyl)-2-(2-chlorophenyl)-1,3-oxazole. InChIKey: BLLYYQSEGWXQDC-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(2-chlorophenyl)-1,3-oxazole |
| InChIKey | BLLYYQSEGWXQDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=CO2)CCl)Cl |
Computed by PubChem (NCBI)