CAS 67967-18-4 appears in our catalog under these names: 5,8-Dichloro-1,7-naphthyridine, 98%, 5,8-Dichloro-1,7-naphthyridine 95%, 5,8-Dichloro-1,7-naphthyridine, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 500mg.
5,8-dichloro-1,7-naphthyridine (CAS 67967-18-4) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 5,8-dichloro-1,7-naphthyridine. InChIKey: CDCLDEAJFLGQNB-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 5,8-dichloro-1,7-naphthyridine |
| InChIKey | CDCLDEAJFLGQNB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=C2Cl)Cl)N=C1 |
Computed by PubChem (NCBI)