Products 68978-27-8
CAS 68978-27-8 appears in our catalog under these names: 4-Methoxy-2-methylbenzene-1-sulfonyl chloride, 4-Methoxy-2-methylbenzenesulfonyl chloride 98%. Offered by: Biosynth, Ambeed. Available pack sizes: 0,5g, 5g, 250mg, 1g.
4-methoxy-2-methylbenzenesulfonyl chloride (CAS 68978-27-8) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 4-methoxy-2-methylbenzenesulfonyl chloride. InChIKey: ORRJJCXQZGXRPU-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 4-methoxy-2-methylbenzenesulfonyl chloride |
| InChIKey | ORRJJCXQZGXRPU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)