Products 70057-67-9
CAS 70057-67-9 appears in our catalog under these names: 5–(3–Chlorophenyl)–1，3，4–thiadiazol–2–amine, 5-(3-Chlorophenyl)-1,3,4-thiadiazol-2-amine, 5-(3-Chlorophenyl)-1,3,4-thiadiazol-2-amine 95%, 5-(3-Chlorophenyl)-1,3,4-thiadiazol-2-amine, 95%(LC-MS),RG, 95%(LC-MS),RG, 5-(3-chlorophenyl)-1,3,4-thiadiazol-2-amine, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 2,5g, 0,25g, 100g, 250mg.
5-(3-chlorophenyl)-1,3,4-thiadiazol-2-amine (CAS 70057-67-9) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 5-(3-chlorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: JVPYRGXPTAPRJU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | JVPYRGXPTAPRJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NN=C(S2)N |
Computed by PubChem (NCBI)