CAS 703-49-1 appears in our catalog under these names: 7,8-Dichloroquinoline, 98%, 7,8-Dichloroquinoline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 1g, 5g, 10g.
7,8-dichloroquinoline (CAS 703-49-1) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 7,8-dichloroquinoline. InChIKey: BQNIWGUGRICGFJ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 7,8-dichloroquinoline |
| InChIKey | BQNIWGUGRICGFJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)Cl)Cl)N=C1 |
Computed by PubChem (NCBI)