CAS 630421-73-7 appears in our catalog under these names: 1,6-Dichloro-isoquinoline, 97%, 1,6–dichloroisoquinoline, 1,6-Dichloroisoquinoline 97%, 1,6-Dichloroisoquinoline, 98%, 98%, 1,6-Dichloroisoquinoline, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg.
1,6-dichloroisoquinoline (CAS 630421-73-7) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,6-dichloroisoquinoline. InChIKey: JTCCQIDTKFGEQY-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,6-dichloroisoquinoline |
| InChIKey | JTCCQIDTKFGEQY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2Cl)C=C1Cl |
Computed by PubChem (NCBI)