CAS 613-77-4 appears in our catalog under these names: 2,7-dichloroquinoline, 97%, 2,7-Dichloroquinoline, 98%, 2,7-Dichloroquinoline, 2,7-dichloroquinoline, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 500mg, 2.5g.
2,7-dichloroquinoline (CAS 613-77-4) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 2,7-dichloroquinoline. InChIKey: VOGBOMUONXLUTI-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 2,7-dichloroquinoline |
| InChIKey | VOGBOMUONXLUTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)