CAS 40635-11-8 appears in our catalog under these names: 6,7-Dichloroquinoline, 98%, 6,7-Dichloroquinoline, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 5g, 1g.
6,7-dichloroquinoline (CAS 40635-11-8) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 6,7-dichloroquinoline. InChIKey: VOEBOQZMOGFLTJ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 6,7-dichloroquinoline |
| InChIKey | VOEBOQZMOGFLTJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2N=C1)Cl)Cl |
Computed by PubChem (NCBI)