CAS 15298-58-5 appears in our catalog under these names: 1,4-Dichloroisoquinoline, 98%, 1,4-Dichloroisoquinoline, 95%, 95%, 1,4-Dichloroisoquinoline, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100mg.
1,4-dichloroisoquinoline (CAS 15298-58-5) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,4-dichloroisoquinoline. InChIKey: HAOKHVBZPIURMZ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,4-dichloroisoquinoline |
| InChIKey | HAOKHVBZPIURMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Cl)Cl |
Computed by PubChem (NCBI)