CAS 613-18-3 appears in our catalog under these names: 2,3-Dichloroquinoline, 97%, 2,3-Dichloroquinoline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2,3-dichloroquinoline (CAS 613-18-3) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 2,3-dichloroquinoline. InChIKey: KWVNKWCJDAWNAE-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 2,3-dichloroquinoline |
| InChIKey | KWVNKWCJDAWNAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)