CAS 61563-36-8 appears in our catalog under these names: 7,8-Dichloroisoquinoline, 98%, 7,8-Dichloroisoquinoline, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100mg, 250mg.
7,8-dichloroisoquinoline (CAS 61563-36-8) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 7,8-dichloroisoquinoline. InChIKey: MYYHZQIWSAUHJB-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 7,8-dichloroisoquinoline |
| InChIKey | MYYHZQIWSAUHJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN=C2)Cl)Cl |
Computed by PubChem (NCBI)