CAS 70810-24-1 appears in our catalog under these names: 1,7-Dichloroisoquinoline, 97%, 1,7-Dichloroisoquinoline 95%, Isoquinoline, 1,7-dichloro-, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 100mg, 250mg.
1,7-dichloroisoquinoline (CAS 70810-24-1) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,7-dichloroisoquinoline. InChIKey: NRBSVPXPMBQUGX-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,7-dichloroisoquinoline |
| InChIKey | NRBSVPXPMBQUGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN=C2Cl)Cl |
Computed by PubChem (NCBI)