CAS 703-66-2 appears in our catalog under these names: 6,8-Dichloroquinoline, 98%, 6,8-Dichloroquinoline, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 1g, 100g, 5g, 100mg, 250mg.
6,8-dichloroquinoline (CAS 703-66-2) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 6,8-dichloroquinoline. InChIKey: LAHRXLPRNCGSAB-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 6,8-dichloroquinoline |
| InChIKey | LAHRXLPRNCGSAB-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)Cl)Cl |
Computed by PubChem (NCBI)