CAS 848841-64-5 appears in our catalog under these names: 1,8-Dichloroisoquinoline, 95%, 1,8-Dichloroisoquinoline 96%, Isoquinoline, 1,8-dichloro-, 96%, 96%, 1,8-Dichloroisoquinoline, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
1,8-dichloroisoquinoline (CAS 848841-64-5) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,8-dichloroisoquinoline. InChIKey: SPANHWVVFLSTMH-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,8-dichloroisoquinoline |
| InChIKey | SPANHWVVFLSTMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=NC=C2)Cl |
Computed by PubChem (NCBI)