CAS 7033-50-3 is the registry number for 6-Chloro-2-methyl-4H-benzo[d][1,3]oxazin-4-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2-methyl-3,1-benzoxazin-4-one (CAS 7033-50-3) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 6-chloro-2-methyl-3,1-benzoxazin-4-one. InChIKey: UXMVQZIDRMBYRK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 6-chloro-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | UXMVQZIDRMBYRK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)Cl)C(=O)O1 |
Computed by PubChem (NCBI)