CAS 70382-03-5 is the registry number for 4-Hydroxy-3-nitrobenzamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
4-hydroxy-3-nitrobenzamide (CAS 70382-03-5) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-hydroxy-3-nitrobenzamide. InChIKey: ZRSSXZYQEVYUAZ-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-hydroxy-3-nitrobenzamide |
| InChIKey | ZRSSXZYQEVYUAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)[N+](=O)[O-])O |
Computed by PubChem (NCBI)