CAS 70916-98-2 appears in our catalog under these names: 4'-Formylbiphenyl-4-carboxylic acid, 98%, 4'–Formyl–(1,1'–Biphenyl)–4–carboxylic Acid, 4-(4-formylphenyl)benzoic acid, 4'-Formyl(1,1'-biphenyl)-4-carboxylic acid, 97% , 4'-Formyl-[1,1'-biphenyl]-4-carboxylic acid 98%. Offered by: Fluorochem, GLPBio, Biosynth, Thermo Scientific, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 500mg, 2.5g, 5g, 10g, 25g.
4-(4-formylphenyl)benzoic acid (CAS 70916-98-2) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 4-(4-formylphenyl)benzoic acid. InChIKey: JCEAFZUEUSBESW-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 4-(4-formylphenyl)benzoic acid |
| InChIKey | JCEAFZUEUSBESW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)