CAS 71679-70-4 appears in our catalog under these names: (2-Oxo-5-phenyl-1,3,4-oxadiazol-3(2h)-yl)acetic acid, 95%, 2-(2-Oxo-5-phenyl-1,3,4-oxadiazol-3(2H)-yl)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetic acid (CAS 71679-70-4) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetic acid. InChIKey: BJXYHDVNKLAICZ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetic acid |
| InChIKey | BJXYHDVNKLAICZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C(=O)O2)CC(=O)O |
Computed by PubChem (NCBI)