CAS 724446-31-5 is the registry number for 2,3-Dihydro-1-benzofuran-6-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,3-dihydro-1-benzofuran-6-sulfonyl chloride (CAS 724446-31-5) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-6-sulfonyl chloride. InChIKey: UHYIBERPFLCTBR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 2,3-dihydro-1-benzofuran-6-sulfonyl chloride |
| InChIKey | UHYIBERPFLCTBR-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)