Products 74214-63-4
CAS 74214-63-4 appears in our catalog under these names: 9H-Pyrido(3,4-b)indole-3-carboxylic acid, 9H-Pyrido[3,4-b]indole-3-carboxylic acid, 98%, 98%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 500mg, 1g.
9H-pyrido[3,4-b]indole-3-carboxylic acid (CAS 74214-63-4) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 9H-pyrido[3,4-b]indole-3-carboxylic acid. InChIKey: ARLVFKCLBYUINL-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 9H-pyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | ARLVFKCLBYUINL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=NC=C3N2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
9H-pyrido[3,4-b]indole-3-carboxylic acid, Carboline-3-carboxylic acid, beta-Carboline carboxylic acid, 9H-Pyrido(3,4-b)indole-3-carboxylic acid, 9H-beta-carboline-3-carboxylic acid, beta-carboline-3-carboxylic acid, 3-carboxy-beta-carboline, b-carboline-3-carboxylic acid, beta-carbolin-3-carboxylic acid, ARLVFKCLBYUINL-UHFFFAOYSA-N