CAS 749240-52-6 appears in our catalog under these names: 4,7–Difluoroisatin, 4,7-Difluoroindoline-2,3-dione, 4,7-Difluoroindoline-2,3-dione, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
4,7-difluoro-1H-indole-2,3-dione (CAS 749240-52-6) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 4,7-difluoro-1H-indole-2,3-dione. InChIKey: ZHGOEPJMKPVIRT-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 4,7-difluoro-1H-indole-2,3-dione |
| InChIKey | ZHGOEPJMKPVIRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)C(=O)C(=O)N2)F |
Computed by PubChem (NCBI)