Products 75445-60-2
CAS 75445-60-2 is the registry number for Anticoronavirus agent-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-methyl-5-phenylmethoxynaphthalene-1,4-dione (CAS 75445-60-2) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: 7-methyl-5-phenylmethoxynaphthalene-1,4-dione. InChIKey: QPPBYEMNWPFRJD-UHFFFAOYSA-N.
| Molecular formula | C18H14O3 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | 7-methyl-5-phenylmethoxynaphthalene-1,4-dione |
| InChIKey | QPPBYEMNWPFRJD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=O)C=CC2=O)C(=C1)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)