CAS 76387-79-6 appears in our catalog under these names: 2–(((Benzyloxy)carbonyl)amino)malonic acid, Cbz-DL-2-COOH-Gly-OH 97%, 2-(((Benzyloxy)carbonyl)amino)malonic acid, 97%, 97%, 2-(((Benzyloxy)carbonyl)amino)malonic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g.
2-(phenylmethoxycarbonylamino)propanedioic acid (CAS 76387-79-6) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)propanedioic acid. InChIKey: ZWVXUZYECNAQFP-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylamino)propanedioic acid |
| InChIKey | ZWVXUZYECNAQFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)