Products 765259-05-0
CAS 765259-05-0 is the registry number for Fmoc-Ala-OH-13C3, 98.5%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 50 mg, 5 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)(1,2,3-13C3)propanoic acid (CAS 765259-05-0) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 314.31 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)(1,2,3-13C3)propanoic acid. InChIKey: QWXZOFZKSQXPDC-XZYMTLJFSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 314.31 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)(1,2,3-13C3)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-XZYMTLJFSA-N |
| SMILES | [13CH3][13C@@H]([13C](=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)