CAS 76655-02-2 is the registry number for 6–chloro–1H–indole–3–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1g.
6-chloro-1H-indole-3-carboxylic acid (CAS 76655-02-2) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 6-chloro-1H-indole-3-carboxylic acid. InChIKey: WHQHEMBHJZAHSB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 6-chloro-1H-indole-3-carboxylic acid |
| InChIKey | WHQHEMBHJZAHSB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC=C2C(=O)O |
Computed by PubChem (NCBI)